62130-80-7 Usage
General Description
(H-Cys-Phe-OH)2 refers to a chemical compound that is a dimer of the dipeptide H-Cys-Phe-OH. Also known as cysteine-phenylalanine dimer, it is composed of two molecules of the dipeptide bonded together. Cysteine is an amino acid known for its role in the formation of disulfide bonds in proteins, while phenylalanine is an essential amino acid involved in the synthesis of proteins. The dimerization of these two dipeptide molecules results in the formation of a larger peptide structure with potential applications in biochemistry, medicine, and pharmaceutical research. (H-CYS-PHE-OH)2 may have functional and structural importance in the body and could potentially be used in the development of new drugs or therapeutic treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 62130-80-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,1,3 and 0 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 62130-80:
(7*6)+(6*2)+(5*1)+(4*3)+(3*0)+(2*8)+(1*0)=87
87 % 10 = 7
So 62130-80-7 is a valid CAS Registry Number.
InChI:InChI=1/C24H30N4O6S2/c25-17(21(29)27-19(23(31)32)11-15-7-3-1-4-8-15)13-35-36-14-18(26)22(30)28-20(24(33)34)12-16-9-5-2-6-10-16/h1-10,17-20H,11-14,25-26H2,(H,27,29)(H,28,30)(H,31,32)(H,33,34)