62216-06-2 Usage
General Description
Quinoline-8-carbothioic acid amide is a chemical compound with a molecular formula C10H9NOS. It is a derivative of quinoline, containing a carbothioic acid amide group. Quinoline-8-Carbothioic Acid Amide has potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science. It has been studied for its potential biological activities, such as anticancer, antimicrobial, and antioxidant properties. Additionally, quinoline-8-carbothioic acid amide has been investigated for its potential role as a ligand in coordination chemistry and as a building block for the synthesis of new organic compounds. Its unique structure and properties make it a subject of interest for further research and potential applications in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 62216-06-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,2,1 and 6 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 62216-06:
(7*6)+(6*2)+(5*2)+(4*1)+(3*6)+(2*0)+(1*6)=92
92 % 10 = 2
So 62216-06-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N2S/c11-10(13)8-5-1-3-7-4-2-6-12-9(7)8/h1-6H,(H2,11,13)
