62492-45-9 Usage
Description
1-Chloro-2-methoxy-4-methyl-5-nitrobenzene is an organic compound with the molecular formula C8H8ClNO3. It is a derivative of benzene, featuring a chlorine atom at the 1st position, a methoxy group at the 2nd position, a methyl group at the 4th position, and a nitro group at the 5th position. 1-Chloro-2-methoxy-4-methyl-5-nitrobenzene is known for its potential applications in various chemical and pharmaceutical processes due to its unique structural features.
Uses
1. Used in Chemical Synthesis:
1-Chloro-2-methoxy-4-methyl-5-nitrobenzene is used as a reactant or reagent in various chemical reactions, particularly in stereoselective synthesis. Its unique functional groups allow for selective reactions, making it a valuable compound in the synthesis of complex organic molecules.
2. Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1-Chloro-2-methoxy-4-methyl-5-nitrobenzene is used as an intermediate in the synthesis of various drugs and drug candidates. Its structural diversity and reactivity make it a promising starting material for the development of new therapeutic agents.
3. Used in Material Science:
1-Chloro-2-methoxy-4-methyl-5-nitrobenzene can also be utilized in the development of novel materials, such as polymers and coatings, due to its chemical properties. Its functional groups can be exploited to create materials with specific properties, such as improved stability or enhanced performance in certain applications.
4. Used in Research and Development:
As a versatile compound with unique structural features, 1-Chloro-2-methoxy-4-methyl-5-nitrobenzene is often used in research and development for the exploration of new chemical reactions, synthesis methods, and potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 62492-45-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,4,9 and 2 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 62492-45:
(7*6)+(6*2)+(5*4)+(4*9)+(3*2)+(2*4)+(1*5)=129
129 % 10 = 9
So 62492-45-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H8ClNO3/c1-5-3-8(13-2)6(9)4-7(5)10(11)12/h3-4H,1-2H3
62492-45-9Relevant articles and documents
KINASE INHIBITORS AND METHODS OF USE
-
Page/Page column 82-83, (2010/04/03)
The present invention provides chemical entities or compounds and pharmaceutical compositions thereof that are capable of modulating certain protein kinases such as mTor, tyrosine kinases, and/or lipid kinases such as PI3 kinase. Also provided in the present invention are methods of using these compositions to modulate activities of one or more of these kinases, especially for therapeutic applications.
Melatonin derivatives - I - Synthesis of N-succinyl-6-chloro-5-methoxytryptamine
Batandier,Marsura,Luu-Duc
, p. 227 - 230 (2007/10/02)
-
Synthesis and evaluation of the antiovulatory activity of a variety of melatonin analogues
Flaugh,Crowell,Clemens,Sawyer
, p. 63 - 69 (2007/10/04)
A series of melatonin analogues was synthesized and examined for ovulation-blocking activity. Deviation from the 5-methoxy group or substitution of the 1 position prevented activity. Activity was not particularly sensitive to minor variations in the N-acyl group nor was it significantly altered by methylation of position 2 or the α-methylene; however, a pronounced enhancement resulted from halogenation of the 6 position.