63285-46-1 Usage
General Description
3-(DIMETHYLAMINO)-1-(10H-PHENOTHIAZIN-2-YL)-2-PROPEN-1-ONE is a complex organic compound belonging to the phenothiazine class of chemicals. Phenothiazines are known for their use in medicinal chemistry, particularly as antipsychotic and antiemetic agents. This particular compound, with its dimethylamino and propenone groups, is likely to have unique chemical properties and potential applications in various fields, including pharmaceuticals and material science. Despite its complex structure, this compound, like all chemicals, is subject to the universal laws of chemistry and exhibits behaviors such as reactivity, stability, and solubility based on its molecular configuration.
Check Digit Verification of cas no
The CAS Registry Mumber 63285-46-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,2,8 and 5 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 63285-46:
(7*6)+(6*3)+(5*2)+(4*8)+(3*5)+(2*4)+(1*6)=131
131 % 10 = 1
So 63285-46-1 is a valid CAS Registry Number.
InChI:InChI=1/C17H16N2OS/c1-19(2)10-9-15(20)12-7-8-17-14(11-12)18-13-5-3-4-6-16(13)21-17/h3-11,18H,1-2H3/b10-9+
63285-46-1Relevant articles and documents
Aromatase inhibitors and apoptotic inducers: Design, synthesis, anticancer activity and molecular modeling studies of novel phenothiazine derivatives carrying sulfonamide moiety as hybrid molecules
Ghorab, Mostafa M.,Alsaid, Mansour S.,Samir, Nermin,Abdel-Latif, Ghada A.,Soliman, Aiten M.,Ragab, Fatma A.,Abou El Ella, Dalal A.
, p. 304 - 315 (2017)
Hybrid molecules are used as anticancer agents to improve effectiveness and diminish drug resistance. So, the current study aimed to introduce twenty novel phenothiazine sulfonamide hybrids 5–22, 24 and 25 of promising anticancer activity. Compounds 11 an
