6340-06-3 Usage
Chemical class
Anthraquinones A group of organic compounds derived from anthracene, characterized by the presence of two carbonyl groups and a quinone structure.
Parent compound
Anthracene A polycyclic aromatic hydrocarbon consisting of three fused benzene rings.
Hydroxy group (-OH)
A hydrogen atom bonded to an oxygen atom, which can form hydrogen bonds and participate in various chemical reactions.
Methoxy group (-OCH3)
A methyl group (-CH3) attached to an oxygen atom, which can influence the compound's polarity and reactivity.
Structure
The compound has a hydroxy group and a methoxyphenyl group attached to the anthracen-9-one structure, which contributes to its unique properties and potential applications.
Medicine
Due to its unique structure, it may have potential therapeutic applications or serve as a starting point for the development of new drugs.
Dyes
The compound's structure and functional groups may make it suitable for use in the dye industry, particularly in the synthesis of colorants for various applications.
Organic synthesis
The compound's functional groups can be used as starting materials for the synthesis of other organic compounds, potentially leading to new products and applications.
Research and development
The unique structure and properties of 10-hydroxy-10-(2-methoxyphenyl)anthracen-9-one make it a subject of interest for further research and development in the pharmaceutical and chemical industries.
Safety and handling
As with any chemical compound, appropriate safety measures should be taken when handling 10-hydroxy-10-(2-methoxyphenyl)anthracen-9-one, including the use of personal protective equipment and proper disposal methods.
Stability
The compound's stability under various conditions (e.g., temperature, light, moisture) should be considered when designing experiments or applications involving its use.
Solubility
The presence of hydroxy and methoxy groups may influence the compound's solubility in different solvents, which can be important for its use in various applications.
Reactivity
The compound's reactivity with other chemicals, including potential reactions with other functional groups, should be considered when designing experiments or applications involving its use.
Check Digit Verification of cas no
The CAS Registry Mumber 6340-06-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,4 and 0 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6340-06:
(6*6)+(5*3)+(4*4)+(3*0)+(2*0)+(1*6)=73
73 % 10 = 3
So 6340-06-3 is a valid CAS Registry Number.
InChI:InChI=1/C21H16O3/c1-24-19-13-7-6-12-18(19)21(23)16-10-4-2-8-14(16)20(22)15-9-3-5-11-17(15)21/h2-13,23H,1H3