63467-20-9 Usage
Description
5-(2,5-DIMETHOXYPHENYL)-5-OXOVALERIC ACID, also known as DMPV, is a chemical compound with potential pharmaceutical applications. It belongs to the class of synthetic intermediates and has been studied for its potential use in the synthesis of pharmaceutical drugs. DMPV has shown promising results in experimental studies as a building block for drug molecules with potential therapeutic effects. Its chemical structure consists of a valeric acid backbone with a 2,5-dimethoxyphenyl group and a ketone functional group, making it a versatile compound for pharmaceutical research and development.
Uses
Used in Pharmaceutical Industry:
5-(2,5-DIMETHOXYPHENYL)-5-OXOVALERIC ACID is used as a synthetic intermediate for the development of pharmaceutical drugs. Its unique chemical structure allows it to be a versatile building block for the creation of drug molecules with potential therapeutic effects.
Further research and studies are needed to fully understand its potential applications in the field of medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 63467-20-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,4,6 and 7 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 63467-20:
(7*6)+(6*3)+(5*4)+(4*6)+(3*7)+(2*2)+(1*0)=129
129 % 10 = 9
So 63467-20-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H16O5/c1-17-9-6-7-12(18-2)10(8-9)11(14)4-3-5-13(15)16/h6-8H,3-5H2,1-2H3,(H,15,16)
63467-20-9Relevant articles and documents
Acylative Kinetic Resolution of Cyclic Hydroxamic Acids
Yin, Jingwei,Straub, Matthew R.,Liao, Julian D.,Birman, Vladimir B.
supporting information, p. 1546 - 1549 (2022/03/01)
Racemic cyclic hydroxamic acids bearing an aryl substituent adjacent to the hydroxyl group undergo effective acylative kinetic resolution promoted by benzotetramisole (BTM).