637020-64-5 Usage
Description
(S)-ALPHA-(4-METHYLBENZYL)-PROLINE-HCL, a derivative of proline, is a crystalline powder with a unique chemical structure. It is predominantly utilized as a building block in organic synthesis and holds significant potential in the pharmaceutical industry for the development of drugs and drug candidates. (S)-ALPHA-(4-METHYLBENZYL)-PROLINE-HCL has demonstrated potential antiviral and antitumor activities, positioning it as a promising candidate for the creation of novel therapeutic agents.
Uses
Used in Pharmaceutical Industry:
(S)-ALPHA-(4-METHYLBENZYL)-PROLINE-HCL is used as a building block in organic synthesis for the production of various drugs and drug candidates. Its unique chemical structure and biological activities make it a valuable compound for the development of new therapeutic agents.
Used in Antiviral Applications:
(S)-ALPHA-(4-METHYLBENZYL)-PROLINE-HCL is used as an antiviral agent due to its reported potential antiviral activities. It can be employed in the development of new antiviral drugs to combat various viral infections.
Used in Antitumor Applications:
(S)-ALPHA-(4-METHYLBENZYL)-PROLINE-HCL is used as an antitumor agent, given its potential antitumor activities. It can be a key component in the development of innovative cancer treatments, contributing to the advancement of oncology research and drug development.
Used in Medicinal Chemistry Research:
(S)-ALPHA-(4-METHYLBENZYL)-PROLINE-HCL is used as a valuable tool in medicinal chemistry research. Its unique properties and potential applications make it an essential compound for exploring new avenues in drug discovery and therapeutic development.
Check Digit Verification of cas no
The CAS Registry Mumber 637020-64-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,3,7,0,2 and 0 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 637020-64:
(8*6)+(7*3)+(6*7)+(5*0)+(4*2)+(3*0)+(2*6)+(1*4)=135
135 % 10 = 5
So 637020-64-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H17NO2.ClH/c1-10-3-5-11(6-4-10)9-13(12(15)16)7-2-8-14-13;/h3-6,14H,2,7-9H2,1H3,(H,15,16);1H/t13-;/m0./s1