63827-46-3 Usage
Molecular structure
The compound contains a cyano group (CN), a malononitrile group (NC), and a pyrroloquinoline group.
Usage
Commonly used in organic synthesis and medicinal chemistry research.
Potential properties
Has potential medicinal properties and is a subject of ongoing research for drug development.
Safety
Should be handled with care and proper safety protocols due to potential hazardous properties.
Check Digit Verification of cas no
The CAS Registry Mumber 63827-46-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,8,2 and 7 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 63827-46:
(7*6)+(6*3)+(5*8)+(4*2)+(3*7)+(2*4)+(1*6)=143
143 % 10 = 3
So 63827-46-3 is a valid CAS Registry Number.
InChI:InChI=1/C18H15N5/c1-18(2)13-6-4-5-7-14(13)23(3)16-12(10-21)15(22-17(16)18)11(8-19)9-20/h4-7,17,22H,1-3H3