63899-28-5 Usage
Explanation
The compound is named based on its structure, which includes a benzimidazolium cation with various substituents and functional groups.
Explanation
The IUPAC name provides a standardized way to describe the compound's structure.
Explanation
The molecular formula represents the total number of each type of atom present in the molecule.
Explanation
The compound consists of a benzimidazolium cation with a specific group attached, which contributes to its unique properties.
Explanation
These functional groups are present in the compound and contribute to its reactivity and potential applications.
Explanation
The compound is in the form of a salt, specifically a perchlorate salt, which can influence its solubility and reactivity.
Explanation
Due to its unique molecular structure and properties, the compound may have potential applications in various fields, including the development of new drugs, materials, and catalysts.
Explanation
The compound is a complex organic molecule with a large molecular size and multiple functional groups, which can contribute to its unique properties and potential applications.
Structure
Benzimidazolium cation with a 1,3-dimethyl-2H-benzimidazol-2-ylideneethylidene-6-hydroxy-1-hexenyl group attached
Functional Groups
Hydroxyl, Alkene, and Benzimidazole moieties
Salt Form
Perchlorate (ClO4-)
Potential Applications
Pharmaceuticals, Materials Science, and Catalysis
Complex Organic Molecule
Multiple functional groups and a large molecular size
Check Digit Verification of cas no
The CAS Registry Mumber 63899-28-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,8,9 and 9 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 63899-28:
(7*6)+(6*3)+(5*8)+(4*9)+(3*9)+(2*2)+(1*8)=175
175 % 10 = 5
So 63899-28-5 is a valid CAS Registry Number.
InChI:InChI=1/C26H31N4O.ClHO4/c1-27-21-11-5-6-12-22(21)28(2)25(27)17-15-20(10-9-19-31)16-18-26-29(3)23-13-7-8-14-24(23)30(26)4;2-1(3,4)5/h5-8,11-18,31H,9-10,19H2,1-4H3;(H,2,3,4,5)/q+1;/p-1