6406-67-3 Usage
Description
N1,N1,6-Trimethylbenzene-1,3-diamine is an organic compound that serves as an intermediate in the synthesis of various chemical compounds.
Uses
Used in Pharmaceutical Industry:
N1,N1,6-Trimethylbenzene-1,3-diamine is used as an intermediate in the synthesis of Roseoflavin (R685000), an analog that competes with Riboflavin in Lactobacillus casei. It plays a crucial role in the development of Riboflavin kinase substrates and inhibitors, which have potential applications in the pharmaceutical industry for the treatment of various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 6406-67-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,4,0 and 6 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 6406-67:
(6*6)+(5*4)+(4*0)+(3*6)+(2*6)+(1*7)=93
93 % 10 = 3
So 6406-67-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H14N2/c1-7-4-5-8(10)6-9(7)11(2)3/h4-6H,10H2,1-3H3