64376-14-3 Usage
General Description
2-Amino-4-cyano-6-methylpyrimidine is a chemical compound with the molecular formula C6H6N4. It is a pyrimidine derivative with a cyano group and a methyl group attached to the 4 and 6 positions, respectively. 2-AMINO-4-CYANO-6-METHYLPYRIMIDINE is used in the pharmaceutical industry as a building block for the synthesis of various biologically active compounds. It is also utilized in research for its potential applications in medicinal chemistry and drug development. Additionally, 2-amino-4-cyano-6-methylpyrimidine has been investigated for its antimicrobial and anticancer properties, making it a potentially valuable compound for various scientific and industrial purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 64376-14-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,3,7 and 6 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 64376-14:
(7*6)+(6*4)+(5*3)+(4*7)+(3*6)+(2*1)+(1*4)=133
133 % 10 = 3
So 64376-14-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4/c1-4-2-5(3-7)10-6(8)9-4/h2H,1H3,(H2,8,9,10)