65416-21-9 Usage
Structure
Bicyclo[2.2.1]hept-5-en-2-ylethan-1-one oxime
Explanation
The compound has a bicyclic structure with a cyclohexene ring and a ketone group. The oxime functional group is attached to the carbonyl carbon of the ketone.
Explanation
The compound contains three functional groups an oxime group (C=N-OH), a cyclohexene ring (a six-membered ring with alternating single and double bonds), and a ketone group (C=O).
Explanation
Oxime compounds, in general, have been found to exhibit various biological activities, including anti-inflammatory, anti-cancer, and antimicrobial effects. This specific compound may also possess these properties due to its unique structure.
Explanation
Due to its unique structure and potential biological activity, 1-bicyclo[2.2.1]hept-5-en-2-ylethan-1-one oxime may have applications in the development of new drugs or as an intermediate in chemical synthesis.
Explanation
The compound can participate in various chemical reactions due to the presence of its functional groups, such as oxidation, reduction, and substitution reactions.
Explanation
The physical properties of the compound, such as melting point, boiling point, and solubility, are not provided but can be inferred to be influenced by its molecular structure and the presence of its functional groups.
Explanation
The stability of the compound is not provided, but the presence of the oxime functional group may make it more susceptible to certain reactions, such as hydrolysis or oxidation.
Explanation
The compound can be synthesized by reacting bicyclo[2.2.1]hept-5-en-2-ylethan-1-one with hydroxylamine, which will form the oxime functional group.
Functional Groups
Oxime, Cyclohexene, and Ketone
Biological Activity
Potential anti-inflammatory, anti-cancer, and antimicrobial properties
Applications
Potential use in pharmaceuticals or chemical synthesis
Chemical Reactivity
Can undergo reactions typical of oxime, cyclohexene, and ketone functional groups
Physical Properties
Unknown, but likely influenced by its molecular structure and functional groups
Stability
Unknown, but may be affected by the presence of the oxime functional group
Synthesis
Can be synthesized from bicyclo[2.2.1]hept-5-en-2-ylethan-1-one and hydroxylamine
Check Digit Verification of cas no
The CAS Registry Mumber 65416-21-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,4,1 and 6 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 65416-21:
(7*6)+(6*5)+(5*4)+(4*1)+(3*6)+(2*2)+(1*1)=119
119 % 10 = 9
So 65416-21-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H13NO/c1-6(10-11)9-5-7-2-3-8(9)4-7/h2-3,7-9,11H,4-5H2,1H3/b10-6-
