65550-82-5 Usage
General Description
2-Bromo-3-iodo-5-methylpyridine is a type of organic compound that belongs to the class of halogenated pyridines. The key elements in its chemical structure are bromine, iodine, and a pyridine ring joined with a methyl group. Bearing the molecular formula C6H5BrIN, it is relatively heavy due to the presence of Bromine and Iodine. As an organic halide, it's generally used in various organic synthesis processes. The properties of 2-Bromo-3-iodo-5-methylpyridine including its physical properties, toxicity, or reactivity may vary depending on its state (liquid, gas, solid). Its CAS registry number is 61430-15-1. Its applications are mostly relevant in the fields of chemistry and biochemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 65550-82-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,5,5 and 0 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 65550-82:
(7*6)+(6*5)+(5*5)+(4*5)+(3*0)+(2*8)+(1*2)=135
135 % 10 = 5
So 65550-82-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BrIN/c1-4-2-5(8)6(7)9-3-4/h2-3H,1H3
