6575-09-3 Usage
Description
2-CHLORO-6-METHYLBENZONITRILE is an organic compound with the molecular formula C8H6ClN. It is a light cream to light brown fine crystalline powder that has been studied using the FT-IR spectrum in the region of 400-4000 cm-1 by the KBr pellet technique. 2-CHLORO-6-METHYLBENZONITRILE is known for its chemical properties and potential applications in various industries.
Uses
Used in Chemical Synthesis:
2-CHLORO-6-METHYLBENZONITRILE is used as a chemical intermediate for the synthesis of various organic compounds. Its unique structure allows it to be a valuable building block in the creation of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-CHLORO-6-METHYLBENZONITRILE is used as a key component in the development of new drugs. Its specific chemical properties make it suitable for the synthesis of molecules with potential therapeutic applications.
Used in Agrochemical Industry:
2-CHLORO-6-METHYLBENZONITRILE is also utilized in the agrochemical industry for the production of pesticides and other crop protection agents. Its chemical structure can be modified to create compounds that target specific pests or diseases, contributing to more effective and targeted agricultural solutions.
Used in Research and Development:
Due to its unique chemical properties, 2-CHLORO-6-METHYLBENZONITRILE is often used in research and development laboratories. It serves as a starting material for the exploration of new chemical reactions and the development of novel compounds with potential applications in various fields.
Used in Material Science:
In the field of material science, 2-CHLORO-6-METHYLBENZONITRILE can be used as a component in the development of new materials with specific properties. Its incorporation into polymers or other materials can lead to enhanced performance characteristics, such as improved stability or increased reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 6575-09-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,5,7 and 5 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 6575-09:
(6*6)+(5*5)+(4*7)+(3*5)+(2*0)+(1*9)=113
113 % 10 = 3
So 6575-09-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClN/c1-6-3-2-4-8(9)7(6)5-10/h2-4H,1H3
6575-09-3Relevant articles and documents
Method for preparing polysoproxil intermediate
-
Paragraph 0034; 0082-0087, (2021/11/26)
The method comprises the following steps: (1). A hydrogen chloride salt of 2 - chlorine -6 - methylaniline compound 1 is prepared by taking 2 - chlorine -6 - methylaniline compound 1 as a raw material in a suitable solvent, and then subjected to diazotization reaction with a nitration reagent aqueous solution to obtain the diazonium salt 2 - chloro -6 - methylaniline. The iodine-containing reagent is reacted with an iodo reagent to obtain 3 -chloro -2 -iodotoluene compound 2. (2), the compound 2 is reacted with the reactant cyanide to give 2 -chloro -6 -iodo-benzonitrile compound 3. (3), the compound 3 undergoes a hydrolysis reaction to obtain 2 - chloro -6 - methyl benzoic acid compound 4, and the reaction equation is as follows. The method has the advantages of cheap and easily available raw materials, high reaction conversion rate, simplicity and rapidness, mild and controllable reaction conditions, mild reaction conditions, high yield of the obtained product, easy separation and purification, high purity and easy industrial mass production.
1,3-Dihydro-3-(2-hydroxy-, 2-bromo- or 2-chloroethyl)-2H-isoindol-1-one derivatives
-
, (2008/06/13)
Derivatives of 1,3-dihydro-3-(2-hydroxyethyl) -2H-isoindol-1-one are disclosed. The derivatives are useful for treating ulcers in a mammal and for preventing or decreasing the secretion or availability of excessive amounts of gastric or hydrochloric acid in a mammal suffering from hyperchlorhydria and/or associated conditions.