662138-96-7 Usage
Description
N-Phenyldiethanolamine 2-pyridylboronate is a chemical compound that serves as a reactant in Suzuki-Miyaura cross-coupling reactions, which are widely used in the synthesis of various organic compounds, including pharmaceuticals and advanced materials. It may contain varying amounts of isopropanol and N-phenyldiethanolamine as stabilizers. N-Phenyldiethanolamine 2-pyridylboronate is a white to light yellow crystal powder.
Uses
Used in Pharmaceutical Industry:
N-Phenyldiethanolamine 2-pyridylboronate is used as a reactant for the synthesis of 2-pyridylboronate, which is an essential component in the development of various pharmaceuticals. N-Phenyldiethanolamine 2-pyridylboronate plays a crucial role in the Suzuki-Miyaura cross-coupling reactions, enabling the creation of new drug molecules with improved properties and therapeutic effects.
Used in Advanced Material Synthesis:
In the field of advanced materials, N-Phenyldiethanolamine 2-pyridylboronate is used as a reactant for the synthesis of 2-pyridylboronate, which is a key building block in the development of novel materials with unique properties. These materials can be utilized in various applications, such as electronics, energy storage, and sensors, due to their enhanced performance and functionality.
Used in Chemical Research:
N-Phenyldiethanolamine 2-pyridylboronate is also used as a reactant in chemical research, particularly in the field of organic chemistry. N-Phenyldiethanolamine 2-pyridylboronate is valuable for the synthesis of complex organic molecules and the exploration of new reaction pathways, contributing to the advancement of chemical knowledge and the development of innovative chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 662138-96-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,6,2,1,3 and 8 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 662138-96:
(8*6)+(7*6)+(6*2)+(5*1)+(4*3)+(3*8)+(2*9)+(1*6)=167
167 % 10 = 7
So 662138-96-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H17BN2O2/c1-2-6-14(7-3-1)18-10-12-19-16(20-13-11-18)15-8-4-5-9-17-15/h1-9H,10-13H2
