66298-10-0 Usage
Description
4-(5-CHLORO-2-METHYLPHENYL)-3-THIOSEMICARBAZIDE is a chemical compound with the formula C8H10ClN3S. It is a thiosemicarbazide derivative, which means it contains a sulfur atom and a semicarbazide group. 4-(5-CHLORO-2-METHYLPHENYL)-3-THIOSEMICARBAZIDE is often used in organic chemistry for its versatile reactivity, and it has potential applications in pharmaceuticals and agrochemicals. The presence of the chloro and methyl groups on the phenyl ring gives this compound unique properties and may make it useful in the development of new drugs or pesticides. Additionally, the thiosemicarbazide moiety provides the potential for it to act as a chelating agent or form coordination compounds with metal ions. Overall, 4-(5-chloro-2-methylphenyl)-3-thiosemicarbazide is a chemically interesting compound with potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
4-(5-CHLORO-2-METHYLPHENYL)-3-THIOSEMICARBAZIDE is used as a building block for the development of new drugs due to its unique properties and reactivity. The presence of the chloro and methyl groups on the phenyl ring, along with the thiosemicarbazide moiety, makes it a promising candidate for the synthesis of pharmaceutical compounds.
Used in Agrochemical Industry:
4-(5-CHLORO-2-METHYLPHENYL)-3-THIOSEMICARBAZIDE is used as a precursor in the synthesis of agrochemicals, such as pesticides. Its unique structure and reactivity make it a valuable component in the development of new and effective agrochemical products.
Used in Coordination Chemistry:
4-(5-CHLORO-2-METHYLPHENYL)-3-THIOSEMICARBAZIDE is used as a chelating agent or to form coordination compounds with metal ions. This application allows for the exploration of its potential use in various fields, such as catalysis, materials science, and supramolecular chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 66298-10-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,2,9 and 8 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 66298-10:
(7*6)+(6*6)+(5*2)+(4*9)+(3*8)+(2*1)+(1*0)=150
150 % 10 = 0
So 66298-10-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H10ClN3S/c1-5-2-3-6(9)4-7(5)11-8(13)12-10/h2-4H,10H2,1H3,(H2,11,12,13)