670253-59-5 Usage
General Description
3-AMINO-1-PYRROLIDIN-1-YL-PROPAN-1-ONE HCL is a chemical compound that consists of 3-amino-1-pyrrolidin-1-yl-propan-1-one hydrochloride. It is a synthetic compound with potential psychoactive effects, and it is often used in research and experimentation. The compound may have applications in the development of pharmaceuticals or as a precursor for other chemical reactions. It is important to handle and use this compound with care, following proper safety procedures and guidelines to avoid potential hazards associated with its handling and use.
Check Digit Verification of cas no
The CAS Registry Mumber 670253-59-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,7,0,2,5 and 3 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 670253-59:
(8*6)+(7*7)+(6*0)+(5*2)+(4*5)+(3*3)+(2*5)+(1*9)=155
155 % 10 = 5
So 670253-59-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H14N2O.ClH/c8-4-3-7(10)9-5-1-2-6-9;/h1-6,8H2;1H
670253-59-5Relevant articles and documents
AZAARENE DERIVATIVES
-
Page/Page column 57, (2008/06/13)
A compound represented by the general formula: wherein X1 represents a nitrogen atom or a group represented by the formula -CR10=; X2 represents a nitrogen atom or a group represented by the formula -CR11=; Y represents an oxygen atom or the like; R1 represents a C1-6 alkoxy group, an optionally substituted C6-10 aryloxy group, a group represented by the formula -NR12aR12b or the like; R2 represents a hydrogen atom, an optionally substituted C1-6 alkyl group, or the like; R3, R4, R5, R6, R7, R8, R10 and R11 each independently represent a hydrogen atom, a halogen atom, an optionally substituted C1-6 alkyl group, or the like; R9 represents a group represented by the formula -NR16aR16b or the like; and R12a, R12b, R16a and R16b each independently represent a hydrogen atom, an optionally substituted C1-6 alkyl group, or the like, a salt thereof, or a hydrate of the foregoing.
