68133-98-2 Usage
Description
N-4-NITROBENZYL-N-PROPYLAMINE HYDROCHLORIDE is a chemical compound that serves as a derivatization reagent in analytical chemistry. It is characterized by its ability to react with amines, which allows for the extraction and determination of trace amounts of specific compounds in various samples.
Uses
Used in Environmental Analysis:
N-4-NITROBENZYL-N-PROPYLAMINE HYDROCHLORIDE is used as a derivatization reagent for the extraction of amine in the determination of trace amounts of diisocyanate monomers in contaminated air. This application is particularly relevant for environmental monitoring and ensuring the safety of air quality in various settings.
In this context, the compound plays a crucial role in an electroanalytical method, which is a technique that measures the current or charge associated with the transfer of electrons at an electrode surface. The use of N-4-NITROBENZYL-N-PROPYLAMINE HYDROCHLORIDE enhances the sensitivity and selectivity of the method, allowing for the accurate detection and quantification of diisocyanate monomers even at very low concentrations. This is important for identifying potential health hazards and taking appropriate measures to mitigate exposure risks.
Check Digit Verification of cas no
The CAS Registry Mumber 68133-98-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,1,3 and 3 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 68133-98:
(7*6)+(6*8)+(5*1)+(4*3)+(3*3)+(2*9)+(1*8)=142
142 % 10 = 2
So 68133-98-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2O2.ClH/c1-2-7-11-8-9-3-5-10(6-4-9)12(13)14;/h3-6,11H,2,7-8H2,1H3;1H