6831-10-3 Usage
Description
Amaralin, also known as decahydrooxireno[1,2]azuleno[6,5-b]furan-5(1aH)-one, is an azulenofuran derivative characterized by the presence of a hydroxy group at position 8, methyl groups at positions 2 and 7a, and a methylidene group at position 6. This unique chemical structure endows Amaralin with potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
Amaralin is used as a pharmaceutical compound for its potential therapeutic properties. The specific application reason is not provided in the materials, but its unique chemical structure suggests that it may have biological activities or interactions with biological systems that could be harnessed for medicinal purposes.
Used in Chemical Research:
Amaralin is used as a research compound in the field of chemical research for studying its chemical properties, reactivity, and potential applications in the synthesis of other compounds. The azulenofuran class of compounds may have unique characteristics that make them valuable for understanding various chemical reactions and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 6831-10-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,8,3 and 1 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 6831-10:
(6*6)+(5*8)+(4*3)+(3*1)+(2*1)+(1*0)=93
93 % 10 = 3
So 6831-10-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H20O4/c1-6-4-9-8(7(2)14(17)18-9)5-15(3)10(6)11-12(19-11)13(15)16/h6,8-13,16H,2,4-5H2,1,3H3/t6-,8-,9+,10-,11-,12-,13+,15+/m1/s1