68610-43-5 Usage
General Description
Disodium 1-[2-(2-carboxyethoxy)ethyl]-1(or 3)-(2-carboxyethyl)-4,5-dihydro-2-undecyl-1H-imidazolium hydroxide is a complex chemical compound with a long and intricate name. It is used in the production of surfactants, which are commonly used in detergents, emulsifiers, and other cleaning products. disodium 1-[2-(2-carboxyethoxy)ethyl]-1(or 3)-(2-carboxyethyl)-4,5-dihydro-2-undecyl-1H-imidazolium hydroxide is known for its ability to lower the surface tension of liquids, making it easier to spread and mix with other substances. It has also been used in the pharmaceutical industry as an ingredient in certain medications. Additionally, it has been studied for its potential antimicrobial properties, making it a possible candidate for use in disinfectants and sanitizing products.
Check Digit Verification of cas no
The CAS Registry Mumber 68610-43-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,6,1 and 0 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 68610-43:
(7*6)+(6*8)+(5*6)+(4*1)+(3*0)+(2*4)+(1*3)=135
135 % 10 = 5
So 68610-43-5 is a valid CAS Registry Number.
InChI:InChI=1/C22H40N2O5.2Na.H2O/c1-2-3-4-5-6-7-8-9-10-11-20-23(14-12-21(25)26)15-16-24(20)17-19-29-18-13-22(27)28;;;/h2-19H2,1H3,(H-,25,26,27,28);;;1H2/q;2*+1;/p-2