688031-83-6 Usage
General Description
The chemical "Butanoic acid, 2-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]-3-methyl-,(2S)-" is a complex compound with a molecular structure consisting of butanoic acid, 2-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]-3-methyl-, and isomer (2S)-. Butanoic acid, 2-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]-3-methyl-,(2S)- is a derivative of butanoic acid, which is a carboxylic acid with a four-carbon chain. The presence of the isoindol-2-yl group and the methyl group adds complexity to the chemical structure. Butanoic acid, 2-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]-3-methyl-,(2S)- may have various applications in pharmaceuticals, organic synthesis, or chemical research due to its unique molecular composition and potential reactivity. Further experimentation and analysis are needed to fully understand the properties and potential uses of this chemical.
Check Digit Verification of cas no
The CAS Registry Mumber 688031-83-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,8,8,0,3 and 1 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 688031-83:
(8*6)+(7*8)+(6*8)+(5*0)+(4*3)+(3*1)+(2*8)+(1*3)=186
186 % 10 = 6
So 688031-83-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H13NO5/c1-7(2)10(13(17)18)19-14-11(15)8-5-3-4-6-9(8)12(14)16/h3-7,10H,1-2H3,(H,17,18)/t10-/m0/s1