68986-76-5 Usage
Description
Copper(I) thiophene-2-carboxylate is a chemical compound with the formula CuTC. It is a solid substance that has been widely utilized in various chemical reactions and processes due to its unique properties and reactivity.
Uses
1. Used in Chemical Research:
Copper(I) thiophene-2-carboxylate is used as a reactant or reagent for studies of xenobiotic response safener derivatives, synthesis of functionalized BODIPY dye analogs, orthogonal cross-coupling reactions, preparation of the parent borondipyrromethene system, and copper-mediated cross-coupling.
2. Used in Pharmaceutical Industry:
In the pharmaceutical industry, Copper(I) thiophene-2-carboxylate is used as a mediator in intermolecular cross-coupling reactions, asymmetric 1,4-additions, and allylation reactions. These processes are essential for the synthesis of various pharmaceutical compounds and contribute to the development of new drugs.
3. Used in Dye Synthesis:
Copper(I) thiophene-2-carboxylate is used as a key component in the synthesis of functionalized BODIPY dye analogs. These dyes have a wide range of applications, including as fluorescent markers in biological research and as sensitizers in solar cells.
4. Used in Catalyst Development:
In the field of catalysis, Copper(I) thiophene-2-carboxylate is employed in the development of new catalysts for various chemical reactions, such as cross-coupling and allylation reactions. These catalysts play a crucial role in enhancing the efficiency and selectivity of chemical processes.
5. Used in Material Science:
Copper(I) thiophene-2-carboxylate is also utilized in the preparation of the parent borondipyrromethene system, which is an important class of materials with potential applications in optoelectronics and photovoltaics.
Check Digit Verification of cas no
The CAS Registry Mumber 68986-76-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,9,8 and 6 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 68986-76:
(7*6)+(6*8)+(5*9)+(4*8)+(3*6)+(2*7)+(1*6)=205
205 % 10 = 5
So 68986-76-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H4O2S.Cu/c6-5(7)4-2-1-3-8-4;/h1-3H,(H,6,7);/q;+1/p-1
