69006-89-9 Usage
Description
(3-BROMOPHENYL)SUCCINIC ACID, also known as 2-(3-Bromophenyl)butanedioic Acid, is an organic compound with a molecular structure that features a bromophenyl group and a succinic acid backbone. It is a key intermediate in the synthesis of various pharmaceutical compounds due to its unique chemical properties and reactivity.
Uses
Used in Pharmaceutical Synthesis:
(3-BROMOPHENYL)SUCCINIC ACID is used as a key intermediate for the synthesis of various pharmaceutical compounds, including 1-phenylamino-3-phenylpyrrolidine-2,5-dione derivatives and N-methylpyridyl derivatives of mand p-bromophenylsuccinimides. These synthesized compounds possess anticonvulsant properties, making them valuable in the development of treatments for seizure disorders and epilepsy.
In the pharmaceutical industry, (3-BROMOPHENYL)SUCCINIC ACID serves as a crucial building block for the creation of novel anticonvulsant drugs. Its unique structure allows for the development of new molecules with potential therapeutic benefits, contributing to the ongoing efforts to improve the treatment options for patients suffering from seizure-related conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 69006-89-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,0,0 and 6 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 69006-89:
(7*6)+(6*9)+(5*0)+(4*0)+(3*6)+(2*8)+(1*9)=139
139 % 10 = 9
So 69006-89-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H9BrO4/c11-7-3-1-2-6(4-7)8(10(14)15)5-9(12)13/h1-4,8H,5H2,(H,12,13)(H,14,15)
