69322-01-6 Usage
General Description
Sodium 4-hydroxyphenylglycolate is a chemical compound commonly used in the production of topical pharmaceutical products. It is a sodium salt of 4-hydroxyphenylglycolic acid, which is a derivative of phenylglycolic acid. sodium 4-hydroxyphenylglycolate has been found to have antimicrobial and antifungal properties, making it a common ingredient in personal care products and cosmetics. It is also used as a preservative in some formulations. Additionally, sodium 4-hydroxyphenylglycolate has been studied for its potential role in inhibiting the growth of certain bacteria and fungi, making it a potentially valuable ingredient in medical and healthcare applications.
Check Digit Verification of cas no
The CAS Registry Mumber 69322-01-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,3,2 and 2 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 69322-01:
(7*6)+(6*9)+(5*3)+(4*2)+(3*2)+(2*0)+(1*1)=126
126 % 10 = 6
So 69322-01-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H8O4.Na/c9-6-3-1-5(2-4-6)7(10)8(11)12;/h1-4,7,9-10H,(H,11,12);/q;+1/p-1
