6936-69-2 Usage
General Description
(2,3,4,5,6-pentahydroxyhexylideneamino)urea is a chemical compound known for its five hydroxyl groups attached to a hexylideneamino group. It is a type of organic compound and is classified as a hexane with five hydroxyl groups and an attached amino group, making it a urea derivative. The compound has a potential for use in various industrial applications, including in the production of pharmaceuticals, polymers, and as a chemical intermediate. Its unique structure and functional groups make it a valuable precursor for creating a wide range of other compounds and materials. Additionally, it may have potential uses in the fields of medicine and biochemistry due to its ability to interact with biological systems and its structural similarity to natural occurring compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 6936-69-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,3 and 6 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 6936-69:
(6*6)+(5*9)+(4*3)+(3*6)+(2*6)+(1*9)=132
132 % 10 = 2
So 6936-69-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H15N3O6/c8-7(16)10-9-1-3(12)5(14)6(15)4(13)2-11/h1,3-6,11-15H,2H2,(H3,8,10,16)/b9-1+
