6936-69-2 Usage
Description
(2,3,4,5,6-pentahydroxyhexylideneamino)urea is a unique organic compound characterized by its five hydroxyl groups attached to a hexylideneamino group. It is a hexane derivative with an additional urea group, which contributes to its potential for diverse applications in various industries.
Uses
Used in Pharmaceutical Industry:
(2,3,4,5,6-pentahydroxyhexylideneamino)urea is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure and functional groups make it a valuable precursor for creating a wide range of medicinal agents.
Used in Polymer Industry:
In the polymer industry, (2,3,4,5,6-pentahydroxyhexylideneamino)urea is used as a monomer or a building block for the development of new polymer materials. Its hydroxyl and amino groups can be utilized in polymerization reactions to create polymers with specific properties.
Used as a Chemical Intermediate:
(2,3,4,5,6-pentahydroxyhexylideneamino)urea serves as a versatile chemical intermediate for the synthesis of other complex organic compounds. Its functional groups can be further modified or reacted to produce a variety of specialized chemicals.
Potential Use in Medicine and Biochemistry:
Due to its ability to interact with biological systems and its structural similarity to naturally occurring compounds, (2,3,4,5,6-pentahydroxyhexylideneamino)urea may have potential applications in medicine and biochemistry. Further research is needed to explore its specific uses in these fields.
Check Digit Verification of cas no
The CAS Registry Mumber 6936-69-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,3 and 6 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 6936-69:
(6*6)+(5*9)+(4*3)+(3*6)+(2*6)+(1*9)=132
132 % 10 = 2
So 6936-69-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H15N3O6/c8-7(16)10-9-1-3(12)5(14)6(15)4(13)2-11/h1,3-6,11-15H,2H2,(H3,8,10,16)/b9-1+
