6939-05-5 Usage
Description
2-Chloro-7-nitrofluorene is an organic compound with the molecular formula C13H7ClN2O2. It is characterized by the presence of a chlorine atom at the 2nd position and a nitro group at the 7th position on a fluorene backbone. 2-CHLORO-7-NITROFLUORENE is known for its unique chemical properties, which make it useful in various applications.
Uses
Used in Chemical Research:
2-Chloro-7-nitrofluorene is used as a reference compound for determining solvent dipolarity and polarizability properties. Its distinct molecular structure allows researchers to study and compare the behavior of solvents in various chemical reactions and processes. This application is particularly important in the field of organic chemistry, where understanding solvent effects is crucial for optimizing reaction conditions and predicting outcomes.
Check Digit Verification of cas no
The CAS Registry Mumber 6939-05-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,3 and 9 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 6939-05:
(6*6)+(5*9)+(4*3)+(3*9)+(2*0)+(1*5)=125
125 % 10 = 5
So 6939-05-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H8ClNO2/c14-10-1-3-12-8(6-10)5-9-7-11(15(16)17)2-4-13(9)12/h1-4,6-7H,5H2
