69745-21-7 Usage
General Description
6-Hydroxy-1-(4-methylphenyl)-1,3-hexanedione is a complex organic chemical compound primarily composed of hydrogen, carbon and oxygen atoms. 6-HYDROXY-1-(4-METHYLPHENYL)-1,3-HEXANEDIONE belongs to the group of benzoyl derivatives, which are aromatic compounds containing an acyl group attached to the benzene ring through a carbon atom. This substance comes under the category of aromatic ketones, featuring a monocyclic ring structure with the presence of one heteroatom in the ring and multiple ketone groups. Its properties and potential applications (if any) within areas such as medicine, manufacturing, or research are not commonly disclosed or referenced, partaking to its complex and specific structure and composition.
Check Digit Verification of cas no
The CAS Registry Mumber 69745-21-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,7,4 and 5 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 69745-21:
(7*6)+(6*9)+(5*7)+(4*4)+(3*5)+(2*2)+(1*1)=167
167 % 10 = 7
So 69745-21-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H16O3/c1-10-4-6-11(7-5-10)13(16)9-12(15)3-2-8-14/h4-7,9,14,16H,2-3,8H2,1H3/b13-9-
