6976-81-4 Usage
Description
(Z)-3-(butylcarbamoylamino)-2-cyano-prop-2-enoic acid is an organic compound with the molecular formula C11H16N4O3, belonging to the class of cyanoacrylic acids. It features a butylcarbamoylamino group and a cyano group attached to a propenoic acid moiety in a cis configuration, which endows it with unique structural and functional properties. (Z)-3-(butylcarbamoylamino)-2-cyano-prop-2-enoic acid serves as a building block in the synthesis of various organic compounds and pharmaceuticals, making it a valuable asset in the field of medicinal chemistry and drug development.
Uses
Used in Pharmaceutical Synthesis:
(Z)-3-(butylcarbamoylamino)-2-cyano-prop-2-enoic acid is used as a key building block for the synthesis of various pharmaceuticals. Its unique structure allows for the creation of a wide range of compounds with potential therapeutic applications.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, (Z)-3-(butylcarbamoylamino)-2-cyano-prop-2-enoic acid is utilized for the development of new drugs. Its structural properties make it a promising candidate for the design and synthesis of novel therapeutic agents.
Used in Organic Chemistry:
(Z)-3-(butylcarbamoylamino)-2-cyano-prop-2-enoic acid is also employed in organic chemistry as a versatile starting material for the synthesis of a variety of organic compounds, contributing to the advancement of chemical research and development.
It is crucial to handle and use (Z)-3-(butylcarbamoylamino)-2-cyano-prop-2-enoic acid with care, adhering to proper safety guidelines and procedures to ensure the safety of researchers and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 6976-81-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,9,7 and 6 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6976-81:
(6*6)+(5*9)+(4*7)+(3*6)+(2*8)+(1*1)=144
144 % 10 = 4
So 6976-81-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H13N3O3/c1-2-3-4-11-9(15)12-6-7(5-10)8(13)14/h6H,2-4H2,1H3,(H,13,14)(H2,11,12,15)/b7-6-
