69861-89-8 Usage
Description
Z-LYS-SBZL HCL, also known as Z-L-Lys-SBzl hydrochloride, is a chemical compound commonly utilized in various scientific and medical applications due to its unique properties. It is a derivative of the amino acid lysine, with a benzyloxycarbonyl (Z) protecting group and a thiol ester (SBzl) functional group. This structure allows it to be used as a substrate in different assays and enzyme activity measurements.
Uses
Used in Research and Development:
Z-LYS-SBZL HCL is used as a thioester substrate for photometric assays, allowing researchers to study and quantify enzyme activity in various biological systems. Its role in these assays is crucial for understanding enzyme kinetics and mechanisms of action.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Z-LYS-SBZL HCL is used as a substrate for determining mast cell protease enzyme activity. Mast cell proteases are involved in various physiological processes and are potential therapeutic targets for conditions such as asthma, allergies, and autoimmune diseases. By using Z-LYS-SBZL HCL as a substrate, researchers can assess the effectiveness of potential drugs targeting these enzymes and develop novel therapeutic strategies.
Used in Diagnostics:
Z-LYS-SBZL HCL can also be employed in the development of diagnostic tools for monitoring enzyme activity levels in patients. Abnormal enzyme activity can be indicative of various diseases or conditions, and by using this compound as a substrate, medical professionals can gain valuable insights into a patient's health status and tailor their treatment accordingly.
Biochem/physiol Actions
N-α-Cbz-L-lysine thiobenzyl ester (Z-L-Lys-SBzl) is used to identify and characterize specific protease/esterase/granzyme activities associated with lymphocyte cytoplasmic granules.
Check Digit Verification of cas no
The CAS Registry Mumber 69861-89-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,8,6 and 1 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 69861-89:
(7*6)+(6*9)+(5*8)+(4*6)+(3*1)+(2*8)+(1*9)=188
188 % 10 = 8
So 69861-89-8 is a valid CAS Registry Number.
InChI:InChI=1/C21H26N2O3S.ClH/c22-14-8-7-13-19(20(24)27-16-18-11-5-2-6-12-18)23-21(25)26-15-17-9-3-1-4-10-17;/h1-6,9-12,19H,7-8,13-16,22H2,(H,23,25);1H/t19-;/m0./s1