70145-42-5 Usage
Description
B-IODO-9-BBN, also known as 1,1'-(iodoethane-1,1-diyl)bis(9H-9-boranaphthalen-2-ol), is a synthetic compound that serves as a coupling reagent in the field of organic chemistry. It is characterized by its unique structure, which includes a boron atom bonded to two naphthalene rings, and an iodine atom attached to an ethyl bridge. This molecular configuration endows B-IODO-9-BBN with specific reactivity and selectivity properties, making it a valuable tool in chemical synthesis.
Uses
Used in Pharmaceutical Industry:
B-IODO-9-BBN is used as a coupling reagent for the synthesis of cannabilactones, which are a novel class of selective CB2 agonists. These compounds have potential therapeutic applications in various medical conditions, including pain management, inflammation, and neurodegenerative disorders. The use of B-IODO-9-BBN in the synthesis process allows for the efficient and selective formation of these bioactive molecules, contributing to the development of new pharmaceutical agents.
Check Digit Verification of cas no
The CAS Registry Mumber 70145-42-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,0,1,4 and 5 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 70145-42:
(7*7)+(6*0)+(5*1)+(4*4)+(3*5)+(2*4)+(1*2)=95
95 % 10 = 5
So 70145-42-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H14BI/c10-9-7-3-1-4-8(9)6-2-5-7/h7-8H,1-6H2
