704884-76-4 Usage
General Description
4,5-Difluoro-2-methylphenol is a specialized chemical compound that contains elements of fluorine and methyl groups attached to a phenol base structure. 4,5-Difluoro-2-methylphenol, categorized under the family of organofluorines, is generally used in advanced organic synthesis and pharmaceutical research, owing to its specific properties and reactivity. It exemplifies the interaction of various functionalities within a molecule— the phenolic hydroxyl group, the added methyl group and the fluorine substituents. The presence of these groups influences how this chemical reacts with other substances, making it valuable in certain scientific applications. Detailed properties like its molecular weight, boiling point, melting point, etc. are often provided by chemical databases for precise scientific use. However, like many other chemical compounds, it should be handled and stored properly due to its potential hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 704884-76-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,0,4,8,8 and 4 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 704884-76:
(8*7)+(7*0)+(6*4)+(5*8)+(4*8)+(3*4)+(2*7)+(1*6)=184
184 % 10 = 4
So 704884-76-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H6F2O/c1-4-2-5(8)6(9)3-7(4)10/h2-3,10H,1H3
704884-76-4Relevant articles and documents
Fluorine containing benzaldehydes
-
Page 8, (2008/06/13)
Benzaldehyde derivatives (I), phenol derivatives (II) (with the exception of 4-fluoro-2-methylphenol) and benzylamine derivatives (V) (with the exception of 5-fluoro-2-hydroxy-N,N-dimethylbenzylamine) are new. Benzaldehyde derivatives of formula (I), phen
