7078-90-2 Usage
General Description
(5-Bromo-2-methoxy-benzyl)-dimethyl-amine is a chemical compound that contains a bromine atom, a methoxy group, and a dimethylamine moiety. It is commonly used as an intermediate in the synthesis of pharmaceuticals and organic compounds. The compound is known for its ability to modify the properties of other molecules, making it useful in the field of medicinal chemistry. It is also used as a reagent in organic chemistry reactions, such as amine alkylation and reductive amination. The compound is typically handled and stored in a controlled environment due to its potential reactivity and toxicity.
Check Digit Verification of cas no
The CAS Registry Mumber 7078-90-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,0,7 and 8 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 7078-90:
(6*7)+(5*0)+(4*7)+(3*8)+(2*9)+(1*0)=112
112 % 10 = 2
So 7078-90-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H14BrNO/c1-12(2)7-8-6-9(11)4-5-10(8)13-3/h4-6H,7H2,1-3H3
7078-90-2Relevant articles and documents
Metalations utilizing aryllithiums; ortho-functionalization of p-bromoanisole (pBrA)
Slocum,Reece, Troy L.,Sandlin, Rebecca D.,Reinscheld, Thomas K.,Whitley, Paul E.
experimental part, p. 1593 - 1595 (2009/06/18)
An ortho-metalation protocol has been developed, which permits the survival of a bromine substituent in p-bromoanisole. Eight derivatives of the generated ortho-lithiated intermediate have been prepared. A neglected metalation concept is being explored here; one which proposes that minimizing the pKa difference between the aryl substrate and the conjugate acid of the metalating agent will lead to a regiospecific and selective metalation process.
