7154-93-0 Usage
Description
3-[(5-Chloro-3H-benzoimidazol-2-yl)sulfanyl]propanoic acid is a chemical compound that consists of a propanoic acid molecule with an attached 5-chloro-3H-benzoimidazol-2-yl group. It is a versatile chemical with both industrial and medicinal use.
Used in Pharmaceutical Industry:
3-[(5-Chloro-3H-benzoimidazol-2-yl)sulfanyl]propanoic acid is used as a pharmaceutical intermediate for the synthesis of various pharmaceuticals. Its unique structure allows it to be a building block in the development of new drugs.
Used in Anti-inflammatory Applications:
3-[(5-Chloro-3H-benzoimidazol-2-yl)sulfanyl]propanoic acid is being studied for its potential anti-inflammatory properties. Its ability to modulate cellular processes may contribute to reducing inflammation in various medical conditions.
Used in Anti-cancer Applications:
3-[(5-Chloro-3H-benzoimidazol-2-yl)sulfanyl]propanoic acid is also being investigated for its anti-cancer properties. Its potential therapeutic effects may aid in the development of new cancer treatments.
Used in Medical Treatments:
Due to its ability to interact with biological systems, 3-[(5-Chloro-3H-benzoimidazol-2-yl)sulfanyl]propanoic acid may have applications in the treatment of various medical conditions. Its versatility as a chemical compound allows for its use in a wide range of therapeutic areas.
Check Digit Verification of cas no
The CAS Registry Mumber 7154-93-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,1,5 and 4 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 7154-93:
(6*7)+(5*1)+(4*5)+(3*4)+(2*9)+(1*3)=100
100 % 10 = 0
So 7154-93-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H9ClN2O2S/c11-6-1-2-7-8(5-6)13-10(12-7)16-4-3-9(14)15/h1-2,5H,3-4H2,(H,12,13)(H,14,15)
