72282-74-7 Usage
Explanation
The molecular formula represents the number of atoms of each element present in a molecule. In this case, the compound has 7 carbon (C) atoms, 12 hydrogen (H) atoms, and 2 nitrogen (N) atoms.
Explanation
A heterocyclic compound is a cyclic compound containing atoms of at least two different elements. In this case, the compound contains carbon, hydrogen, and nitrogen atoms.
Explanation
A pyrazine ring is a six-membered aromatic ring with two nitrogen atoms. The compound has a pyrazine ring fused to another ring.
Explanation
A pyridazine ring is a six-membered aromatic ring with two nitrogen atoms, similar to a pyrazine ring but with a different fusion pattern. The compound has a pyridazine ring fused to the pyrazine ring.
Explanation
This term refers to the specific classification of the compound, indicating that it is an octahydro derivative of a pyrazinopyridazine.
Explanation
The compound is typically found in a liquid state, with a color ranging from colorless to yellow.
Explanation
The compound is used in various industries due to its diverse range of biological activities and potential applications.
Explanation
The compound is known for its ability to exhibit antiviral, antidepressant, and antitumor properties, making it valuable for research and development in medicine and biotechnology.
Explanation
Due to its diverse range of biological activities, the compound is a subject of interest for research and development in the fields of medicine and biotechnology.
Heterocyclic Compound
Yes
Pyrazine Ring
Present
Pyridazine Ring
Present
Octahydropyrazinopyridazine
Yes
Physical State
Colorless to yellow liquid
Industries
Pharmaceuticals, Agrochemicals, and Materials Science
Biological Activities
Antiviral, Antidepressant, and Antitumor
Research and Development
Medicine and Biotechnology
Check Digit Verification of cas no
The CAS Registry Mumber 72282-74-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,2,8 and 2 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 72282-74:
(7*7)+(6*2)+(5*2)+(4*8)+(3*2)+(2*7)+(1*4)=127
127 % 10 = 7
So 72282-74-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H16N2/c1-2-6-11-9-4-3-8(7-9)10(11)5-1/h8-9H,1-7H2