72768-95-7 Usage
General Description
3-(Difluoromethoxy)benzyl bromide is a specialized chemical intermediate, mostly utilized in various forms of scientific research or in the manufacturing of complex chemical compounds. It contains functional groups like difluoromethoxy and benzyl bromide, enhancing its reactivity and making it beneficial for specific chemical reactions, particularly in organic syntheses. Because of its reactive nature, it should be handled with care, under controlled conditions. Due to its specialized use, it is typically not seen outside of controlled industrial, scientific, or research processes. It is a valuable compound for creating advanced pharmaceuticals, therapeutic chemicals, and other high-value added products. It is characterized by the chemical formula C8H6BrF2O and falls under the organohalogen compound class.
Check Digit Verification of cas no
The CAS Registry Mumber 72768-95-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,7,6 and 8 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 72768-95:
(7*7)+(6*2)+(5*7)+(4*6)+(3*8)+(2*9)+(1*5)=167
167 % 10 = 7
So 72768-95-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H7BrF2O/c9-5-6-2-1-3-7(4-6)12-8(10)11/h1-4,8H,5H2
