72962-09-5 Usage
General Description
2-Amino-5-chloro-6-phenyl-4(1H)-pyrimidinone is a chemical compound with the molecular formula C11H8ClN3O. It is a pyrimidinone derivative with a chlorine atom and a phenyl group attached to the pyrimidine ring. 2-Amino-5-chloro-6-phenyl-4(1H)-pyrimidinone is known for its potential pharmaceutical applications, particularly in the development of antiviral, antibacterial, and anticancer drugs. Its structure and properties make it a promising candidate for further research and development in the field of medicinal chemistry. Additionally, it is used as a building block in the synthesis of various bioactive compounds and pharmaceutical intermediates.
Check Digit Verification of cas no
The CAS Registry Mumber 72962-09-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,2,9,6 and 2 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 72962-09:
(7*7)+(6*2)+(5*9)+(4*6)+(3*2)+(2*0)+(1*9)=145
145 % 10 = 5
So 72962-09-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H8ClN3O/c11-7-8(6-4-2-1-3-5-6)13-10(12)14-9(7)15/h1-5H,(H3,12,13,14,15)
72962-09-5Relevant articles and documents
Synthesis of 6-arylisocytosines and their potential for hydrogen bonding interactions
Patel, Alpa,Lewis, William,Searle, Mark S.,Stevens, Malcolm F.G.,Moody, Christopher J.
supporting information, p. 7339 - 7343 (2015/08/24)
Abstract The synthesis of a number of 6-arylisocytosines, including linked bis-isocytosines, from the reaction of guanidine with β-ketoesters is described. The compounds were investigated for their ability to form hydrogen-bonded structural networks, and for their potential interactions with the telomeric quadruplex forming sequence AGGG(TTAGGG)3.
Pyrimidinones. 1. 2-Amino-5-halo-6-aryl-4(3H)-pyrimidinones. Interferon-inducing antiviral agents
Skulnick,Weed,Eidson,Renis,Wierenga,Stringfellow
, p. 1864 - 1869 (2007/10/02)
-
