7316-92-9 Usage
Description
3-(4-oxocyclohexa-2,5-dien-1-ylidene)carbazamidine is a hydrazone derivative of 1,4-Benzoquinone, an aromatic compound with potential antineoplastic activity. It is characterized by its unique chemical structure, which includes a cyclohexa-2,5-dien-1-ylidene moiety and a carbazamidine group.
Uses
Used in Anticancer Applications:
3-(4-oxocyclohexa-2,5-dien-1-ylidene)carbazamidine is used as an antineoplastic agent for its potential to inhibit the growth and proliferation of cancer cells. Its hydrazone structure allows it to form covalent bonds with biological targets, such as enzymes and proteins, thereby disrupting essential cellular processes and leading to the death of cancer cells.
Used in Bioconjugation:
3-(4-oxocyclohexa-2,5-dien-1-ylidene)carbazamidine is used as a bioconjugation agent for coupling antigens and antibodies to marker substances such as erythrocytes. Its reactive functional groups enable the formation of stable covalent bonds with biomolecules, facilitating the development of diagnostic and therapeutic applications in the field of immunology and molecular biology.
Used in Drug Delivery Systems:
3-(4-oxocyclohexa-2,5-dien-1-ylidene)carbazamidine can be employed in drug delivery systems to improve the solubility, stability, and bioavailability of therapeutic agents. Its hydrazone moiety can be utilized to form reversible bonds with drug molecules, allowing for controlled release and targeted delivery to specific tissues or cells, enhancing the overall efficacy and safety of the treatment.
Check Digit Verification of cas no
The CAS Registry Mumber 7316-92-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,3,1 and 6 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 7316-92:
(6*7)+(5*3)+(4*1)+(3*6)+(2*9)+(1*2)=99
99 % 10 = 9
So 7316-92-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N4O/c8-7(9)11-10-5-1-3-6(12)4-2-5/h1-4H,(H4,8,9,11)
