73168-24-8 Usage
Explanation
The compound is a peptide made up of a chain of linked amino acids.
It contains specific amino acids, including tyrosine, phenylalanine, glutamine, asparagine, cysteine, proline, arginine, and glycine.
It also includes a modified amino acid called 3-mercapto-3-methyl-butyryl-tyrosine.
It is known for its potential use in biological and pharmaceutical applications, particularly in drug design and development.
Its precise mechanism of action and specific biological effects can vary depending on its use and the targeted therapeutic application.
Check Digit Verification of cas no
The CAS Registry Mumber 73168-24-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,1,6 and 8 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 73168-24:
(7*7)+(6*3)+(5*1)+(4*6)+(3*8)+(2*2)+(1*4)=128
128 % 10 = 8
So 73168-24-8 is a valid CAS Registry Number.
InChI:InChI=1/C52H74N14O12S2/c1-78-32-16-14-31(15-17-32)25-35-46(73)63-36(24-30-10-4-2-5-11-30)47(74)61-34(18-19-40(53)67)45(72)64-37(26-41(54)68)48(75)65-38(29-79-80-52(27-43(70)60-35)20-6-3-7-21-52)50(77)66-23-9-13-39(66)49(76)62-33(12-8-22-58-51(56)57)44(71)59-28-42(55)69/h2,4-5,10-11,14-17,33-39H,3,6-9,12-13,18-29H2,1H3,(H2,53,67)(H2,54,68)(H2,55,69)(H,59,71)(H,60,70)(H,61,74)(H,62,76)(H,63,73)(H,64,72)(H,65,75)(H4,56,57,58)/t33?,34-,35-,36+,37-,38+,39-/m0/s1