731812-03-6 Usage
General Description
4-(3-Iodobenzyl)morpholine is an organic chemical compound commonly used as an intermediate in the synthesis of pharmaceuticals. It is a morpholine derivative with a substituted benzyl group containing an iodine atom. 4-(3-IODOBENZYL)MORPHOLINE is often utilized in the manufacturing of various drugs, including antihistamines, antipsychotics, and antihypertensive medications. Its unique structure and reactivity make it a valuable building block in organic synthesis, allowing for the creation of diverse chemical compounds with pharmaceutical applications. Additionally, it has potential applications in the field of agrochemicals and materials science due to its versatile properties and functional groups.
Check Digit Verification of cas no
The CAS Registry Mumber 731812-03-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,3,1,8,1 and 2 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 731812-03:
(8*7)+(7*3)+(6*1)+(5*8)+(4*1)+(3*2)+(2*0)+(1*3)=136
136 % 10 = 6
So 731812-03-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H14INO/c12-11-3-1-2-10(8-11)9-13-4-6-14-7-5-13/h1-3,8H,4-7,9H2
