732-85-4 Usage
Description
L-Leucine Beta-Naphthylamide, also known as L-Leucine-β-naphthylamide, is an L-leucine derivative that is formed by the formal condensation of the carboxy group of L-leucine with the amino group of 2-naphthylamine. L-LEUCINE BETA-NAPHTHYLAMIDE has various applications in different fields, particularly in the synthesis of protein tyrosine phosphatase inhibitors and as an agent to combat Leishmania major.
Uses
Used in Pharmaceutical Industry:
L-Leucine Beta-Naphthylamide is used as a synthetic compound for the development of protein tyrosine phosphatase inhibitors. These inhibitors play a crucial role in regulating cellular signaling pathways and have potential applications in the treatment of various diseases.
Used in Medical Research:
L-Leucine Beta-Naphthylamide serves as an agent to combat Leishmania major, a protozoan parasite that causes leishmaniasis, a disease affecting millions of people worldwide. Its use in medical research aids in the development of new treatments and therapies for this disease.
Used in Enzyme Activity Assays:
L-Leucine Beta-Naphthylamide is used as a substrate to measure the activity of various enzymes, such as aminopeptidase in Escherichia coli, cathepsin H from rabbit skeletal muscles, and L-Leucine aminopeptidase. These assays are essential for understanding the function and regulation of these enzymes, which can have implications in various biological processes and disease mechanisms.
Check Digit Verification of cas no
The CAS Registry Mumber 732-85-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,3 and 2 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 732-85:
(5*7)+(4*3)+(3*2)+(2*8)+(1*5)=74
74 % 10 = 4
So 732-85-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H20N2O/c1-11(2)9-15(17)16(19)18-14-8-7-12-5-3-4-6-13(12)10-14/h3-8,10-11,15H,9,17H2,1-2H3,(H,18,19)
