73403-52-8 Usage
Description
6-OXO-1,6-DIHYDRO-PYRAZINE-2,3-DICARBOXYLIC ACID DIAMIDE is a chemical compound with the molecular formula C6H8N2O4. It is a dipeptide derivative, meaning it consists of two amino acid units linked by a peptide bond. 6-OXO-1,6-DIHYDRO-PYRAZINE-2,3-DICARBOXYLIC ACID DIAMIDE has potential use in pharmaceuticals and biotechnology due to its ability to act as a building block for more complex molecules. Additionally, it has been studied for its potential role in the development of new materials and as a catalyst in chemical reactions. Overall, 6-OXO-1,6-DIHYDRO-PYRAZINE-2,3-DICARBOXYLIC ACID DIAMIDE is an important chemical compound with a variety of potential applications in both the medical and industrial fields.
Uses
Used in Pharmaceutical Industry:
6-OXO-1,6-DIHYDRO-PYRAZINE-2,3-DICARBOXYLIC ACID DIAMIDE is used as a building block for the development of complex pharmaceutical molecules. Its dipeptide structure allows for the creation of innovative drugs with unique properties and therapeutic effects.
Used in Biotechnology Industry:
In the biotechnology field, 6-OXO-1,6-DIHYDRO-PYRAZINE-2,3-DICARBOXYLIC ACID DIAMIDE is utilized for the synthesis of novel bioactive compounds. Its potential as a building block enables the engineering of new molecules with specific biological functions and applications.
Used in Material Science:
6-OXO-1,6-DIHYDRO-PYRAZINE-2,3-DICARBOXYLIC ACID DIAMIDE is employed in the development of new materials. Its unique chemical structure contributes to the creation of advanced materials with improved properties for various applications.
Used as a Catalyst in Chemical Reactions:
6-OXO-1,6-DIHYDRO-PYRAZINE-2,3-DICARBOXYLIC ACID DIAMIDE also serves as a catalyst in various chemical reactions. Its ability to facilitate and enhance the rate of chemical processes makes it a valuable tool in the synthesis of new compounds and the improvement of existing chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 73403-52-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,4,0 and 3 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 73403-52:
(7*7)+(6*3)+(5*4)+(4*0)+(3*3)+(2*5)+(1*2)=108
108 % 10 = 8
So 73403-52-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4O3/c7-5(12)3-4(6(8)13)10-2(11)1-9-3/h1H,(H2,7,12)(H2,8,13)(H,10,11)