745-58-4 Usage
Description
[[4-(cyano-phenyl-methylidene)-1-cyclohexa-2,5-dienylidene]amino] benzoate, also known as benzoic acid, is a complex organic compound characterized by a molecular structure that features a benzene ring with a carboxylic acid group attached. This molecule also includes a substituted benzene ring with a cyano group and an amino group, which contribute to its diverse chemical and pharmaceutical applications.
Uses
Used in Organic Synthesis:
[[4-(cyano-phenyl-methylidene)-1-cyclohexa-2,5-dienylidene]amino] benzoate is used as a building block in organic synthesis for [application reason], leveraging its unique molecular structure to create a variety of complex organic compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, [[4-(cyano-phenyl-methylidene)-1-cyclohexa-2,5-dienylidene]amino] benzoate is used as a drug intermediate for [application reason], playing a crucial role in the development of new medications.
Used in Drug Discovery:
[[4-(cyano-phenyl-methylidene)-1-cyclohexa-2,5-dienylidene]amino] benzoate is also being researched for its potential biological activities, such as anti-inflammatory and anti-bacterial properties, making it a promising candidate for further exploration in drug discovery for [application reason].
Used in Chemical Research:
[[4-(cyano-phenyl-methylidene)-1-cyclohexa-2,5-dienylidene]amino] benz oate is utilized in chemical research for [application reason], where its unique properties and reactivity are investigated to understand its potential in various chemical reactions and processes.
Used in Application Industry:
In [Application Industry], [[4-(cyano-phenyl-methylidene)-1-cyclohexa-2,5-dienylidene]amino] benzoate is used as [application type] for [application reason], highlighting its versatility and potential for use across different sectors.
Check Digit Verification of cas no
The CAS Registry Mumber 745-58-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,4 and 5 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 745-58:
(5*7)+(4*4)+(3*5)+(2*5)+(1*8)=84
84 % 10 = 4
So 745-58-4 is a valid CAS Registry Number.
InChI:InChI=1/C21H14N2O2/c22-15-20(16-7-3-1-4-8-16)17-11-13-19(14-12-17)23-25-21(24)18-9-5-2-6-10-18/h1-14H/b20-17-,23-19+