746595-89-1 Usage
General Description
(R)-3-AMINO-4-(3-FLUORO-PHENYL)-BUTYRIC ACID is a chemical compound with the molecular formula C10H12FNO2. It is a chiral compound, meaning it has a non-superposable mirror image, and is commonly used in pharmaceutical research and development. (R)-3-AMINO-4-(3-FLUORO-PHENYL)-BUTYRIC ACID has a specific stereochemistry, with the (R)-enantiomer being the active form. It is known to have potential therapeutic applications, particularly in the treatment of neurological disorders and mental health conditions. Additionally, its structure contains an amino and carboxylic acid group, making it a valuable building block for the synthesis of various biologically active molecules. Overall, (R)-3-AMINO-4-(3-FLUORO-PHENYL)-BUTYRIC ACID is a versatile compound with potential applications in drug discovery and medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 746595-89-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,4,6,5,9 and 5 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 746595-89:
(8*7)+(7*4)+(6*6)+(5*5)+(4*9)+(3*5)+(2*8)+(1*9)=221
221 % 10 = 1
So 746595-89-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H12FNO2/c11-8-3-1-2-7(4-8)5-9(12)6-10(13)14/h1-4,9H,5-6,12H2,(H,13,14)/t9-/m1/s1