7470-80-6 Usage
Explanation
The compound's full name, which describes its structure and components.
Explanation
The molecular formula represents the number of carbon (C), hydrogen (H), chlorine (Cl), nitrogen (N), and oxygen (O) atoms in the compound.
Explanation
The molecular weight is the mass of one mole of the compound, calculated by adding the atomic weights of all the atoms in the molecular formula.
Explanation
The compound's structure is characterized by the presence of these two functional groups, which contribute to its chemical properties and potential applications.
Explanation
The compound is artificially synthesized in a laboratory and is not found in nature.
Explanation
The compound may be utilized for research purposes, such as studying its chemical properties, potential applications, or interactions with other compounds.
Explanation
The specific properties and potential applications of the compound are not yet fully understood and require further investigation and study.
Molecular Weight
373.91 g/mol
Structure
Contains a piperidyl group and a ketone functional group
Synthetic Compound
Not naturally occurring
Research Purposes
Potential use in scientific research
Further Study
Properties and applications need to be determined
Check Digit Verification of cas no
The CAS Registry Mumber 7470-80-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,7 and 0 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 7470-80:
(6*7)+(5*4)+(4*7)+(3*0)+(2*8)+(1*0)=106
106 % 10 = 6
So 7470-80-6 is a valid CAS Registry Number.
InChI:InChI=1/C21H22ClNO/c22-20-12-8-18(9-13-20)5-4-17-6-10-19(11-7-17)21(24)16-23-14-2-1-3-15-23/h4-13H,1-3,14-16H2