7497-84-9 Usage
Description
Bis[2-oxo-2-(4-phenylphenyl)ethyl] 2,3-dihydroxybutanedioate is a complex organic chemical compound that belongs to the class of oxoacids and derivatives. It features a unique molecular structure with two oxo groups, a phenyl group, and two hydroxyl groups. bis[2-oxo-2-(4-phenylphenyl)ethyl] 2,3-dihydroxybutanedioate has the molecular formula C26H26O8 and is a derivative of butanedioic acid. Its distinctive structure and potential medicinal properties make it a promising candidate for pharmaceutical research and drug development.
Uses
Used in Pharmaceutical Research and Drug Development:
Bis[2-oxo-2-(4-phenylphenyl)ethyl] 2,3-dihydroxybutanedioate is utilized as a chemical intermediate in the synthesis of various pharmaceutical compounds. Its unique structure and potential therapeutic applications make it valuable for the development of new drugs and medications.
Used in Organic Chemistry:
In the field of organic chemistry, bis[2-oxo-2-(4-phenylphenyl)ethyl] 2,3-dihydroxybutanedioate serves as a key component in various chemical reactions and processes. Its presence of oxo and phenyl groups, along with its hydroxyl groups, allows for a wide range of applications in organic synthesis and compound development.
Used in Medicinal Chemistry:
Bis[2-oxo-2-(4-phenylphenyl)ethyl] 2,3-dihydroxybutanedioate is employed as a building block in the design and synthesis of novel bioactive molecules. Its potential medicinal properties and versatile structure make it an attractive candidate for the development of new therapeutic agents and pharmaceuticals.
Used in Chemical Synthesis:
In chemical synthesis, bis[2-oxo-2-(4-phenylphenyl)ethyl] 2,3-dihydroxybutanedioate is used as a reagent or catalyst to facilitate the formation of desired products. Its unique structure and functional groups enable it to participate in various chemical transformations, making it a valuable tool in the synthesis of complex organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 7497-84-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,9 and 7 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 7497-84:
(6*7)+(5*4)+(4*9)+(3*7)+(2*8)+(1*4)=139
139 % 10 = 9
So 7497-84-9 is a valid CAS Registry Number.
InChI:InChI=1/C32H26O8/c33-27(25-15-11-23(12-16-25)21-7-3-1-4-8-21)19-39-31(37)29(35)30(36)32(38)40-20-28(34)26-17-13-24(14-18-26)22-9-5-2-6-10-22/h1-18,29-30,35-36H,19-20H2