75279-55-9 Usage
Description
2-Chloro-6-fluorophenylacetonitrile is an organic compound that features a chlorine atom at the 2nd position and a fluorine atom at the 6th position on a phenyl ring, with an acetonitrile group attached. It is a white crystalline solid and is known for its potential applications in the synthesis of various chemical compounds.
Uses
Used in Pharmaceutical Industry:
2-Chloro-6-fluorophenylacetonitrile is used as a synthetic intermediate for the production of aryl fluorinated building blocks, which are essential in the development of new pharmaceutical compounds. These building blocks can be utilized to create novel drugs with improved properties, such as enhanced bioavailability, selectivity, and reduced side effects.
Used in Chemical Synthesis:
In the field of chemical synthesis, 2-Chloro-6-fluorophenylacetonitrile serves as a key component in the preparation of various organic molecules. Its unique structure allows for a range of reactions, such as substitution, addition, and condensation, which can lead to the formation of diverse chemical products with potential applications in different industries.
Used in Material Science:
2-CHLORO-6-FLUOROPHENYLACETONITRILE may also find applications in material science, where aryl fluorinated building blocks can be used to develop new materials with specific properties. These materials could have potential uses in areas such as electronics, coatings, and advanced materials for various industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 75279-55-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,2,7 and 9 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 75279-55:
(7*7)+(6*5)+(5*2)+(4*7)+(3*9)+(2*5)+(1*5)=159
159 % 10 = 9
So 75279-55-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H5ClFN/c9-7-2-1-3-8(10)6(7)4-5-11/h1-3H,4H2
