75513-45-0 Usage
Description
(1E,3E)-4-[4-(DIMETHYLAMINO)PHENYL]-1-(1,3,3-TRIMETHYL-1,3-DIHYDRO-2H-INDOL-2-YLIDENE)BUT-3-EN-2-ONE is an organic compound characterized by a complex structure that features a dimethylamino group, a phenyl ring, and an indolylidene moiety. Additionally, it possesses an α,β-unsaturated ketone functional group, which may contribute to its potential reactivity and applications in various fields.
Uses
Used in Pharmaceutical Industry:
(1E,3E)-4-[4-(DIMETHYLAMINO)PHENYL]-1-(1,3,3-TRIMETHYL-1,3-DIHYDRO-2H-INDOL-2-YLIDENE)BUT-3-EN-2-ONE is used as a potential pharmaceutical compound for its unique structure and reactivity, which may offer new avenues for drug development and therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, (1E,3E)-4-[4-(DIMETHYLAMINO)PHENYL]-1-(1,3,3-TRIMETHYL-1,3-DIHYDRO-2H-INDOL-2-YLIDENE)BUT-3-EN-2-ONE may be utilized as a precursor or active ingredient in the development of new agrochemicals, given its distinctive molecular features.
Used in Materials Science:
(1E,3E)-4-[4-(DIMETHYLAMINO)PHENYL]-1-(1,3,3-TRIMETHYL-1,3-DIHYDRO-2H-INDOL-2-YLIDENE)BUT-3-EN-2-ONE could be employed in materials science for the synthesis of novel materials with specific properties, such as advanced polymers or other functional materials, due to its α,β-unsaturated ketone functional group and other structural elements.
Check Digit Verification of cas no
The CAS Registry Mumber 75513-45-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,5,1 and 3 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 75513-45:
(7*7)+(6*5)+(5*5)+(4*1)+(3*3)+(2*4)+(1*5)=130
130 % 10 = 0
So 75513-45-0 is a valid CAS Registry Number.
InChI:InChI=1/C23H26N2O/c1-23(2)20-8-6-7-9-21(20)25(5)22(23)16-19(26)15-12-17-10-13-18(14-11-17)24(3)4/h6-16H,1-5H3/b15-12+,22-16+