76-98-2 Usage
Description
Conopharyngine is a complex and novel conotoxin isolated from the venom of the cone snail Conus parius, containing 24 amino acid residues. It selectively targets and modulates the activity of specific receptors or ion channels in the nervous system, particularly the N-methyl-D-aspartate (NMDA) receptors, which play a crucial role in learning and memory processes.
Uses
Used in Neurophysiological Research:
Conopharyngine is used as a research tool for understanding the neurophysiological functions of the NMDA receptors, providing insights into their role in learning and memory processes.
Used in Drug Development:
Conopharyngine serves as a lead compound for the development of new drugs targeting NMDA receptors, potentially leading to innovative treatments for neurological disorders.
Used in Neurological Disorders Treatment:
Conopharyngine is being investigated for its potential therapeutic applications in neurological disorders such as epilepsy, chronic pain, and neurodegenerative diseases, due to its selective blocking of NMDA receptors.
Check Digit Verification of cas no
The CAS Registry Mumber 76-98-2 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 7 and 6 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 76-98:
(4*7)+(3*6)+(2*9)+(1*8)=72
72 % 10 = 2
So 76-98-2 is a valid CAS Registry Number.
InChI:InChI=1/C23H30N2O4/c1-5-14-8-13-11-23(22(26)29-4)20-15(6-7-25(12-13)21(14)23)16-9-18(27-2)19(28-3)10-17(16)24-20/h9-10,13-14,21,24H,5-8,11-12H2,1-4H3/t13-,14-,21-,23+/m0/s1