760-54-3 Usage
Description
2-Heptyl-malonic acid is a dicarboxylic acid derivative, specifically a malonic acid molecule with a heptyl group attached at the carbon-2 position. This organic compound is characterized by its unique structural properties, which may contribute to its potential applications in various industries.
Uses
Used in Pharmaceutical Industry:
2-Heptyl-malonic acid is used as an intermediate compound for the synthesis of various pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs, potentially targeting specific diseases or conditions.
Used in Chemical Synthesis:
In the chemical industry, 2-Heptyl-malonic acid is used as a building block for the synthesis of more complex organic molecules. Its versatile structure makes it a valuable precursor in the creation of various chemical products, including specialty chemicals and materials.
Used in Research and Development:
2-Heptyl-malonic acid is utilized as a research compound in academic and industrial laboratories. Its unique properties make it an interesting subject for studying various chemical reactions and exploring its potential applications in different fields.
Used in Cosmetics Industry:
2-Heptyl-malonic acid may be used as an ingredient in the cosmetics industry, where it could serve as a component in the formulation of skincare products, hair care products, or other personal care items. Its specific role in these products would depend on the desired effects and the formulation's overall composition.
Check Digit Verification of cas no
The CAS Registry Mumber 760-54-3 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,6 and 0 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 760-54:
(5*7)+(4*6)+(3*0)+(2*5)+(1*4)=73
73 % 10 = 3
So 760-54-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H18O4/c1-2-3-4-5-6-7-8(9(11)12)10(13)14/h8H,2-7H2,1H3,(H,11,12)(H,13,14)
