762262-07-7 Usage
General Description
4-(cyclohexylaminocarbonyl)phenylboronic acid is a chemical compound with the molecular formula C14H18BNO3. It is a boronic acid derivative that contains a phenyl ring with a cyclohexylaminocarbonyl group attached to it. 4-(CYCLOHEXYLAMINOCARBONYL)PHENYLBORONIC ACID is widely used as a building block in organic synthesis, particularly in the formation of carbon-carbon and carbon-heteroatom bonds. It is commonly utilized in the synthesis of pharmaceuticals, agrochemicals, and advanced materials due to its versatile reactivity and ability to form stable complexes with various substrates. Additionally, 4-(cyclohexylaminocarbonyl)phenylboronic acid has potential applications in the field of medicinal chemistry, specifically in the development of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 762262-07-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,6,2,2,6 and 2 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 762262-07:
(8*7)+(7*6)+(6*2)+(5*2)+(4*6)+(3*2)+(2*0)+(1*7)=157
157 % 10 = 7
So 762262-07-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H18BNO3/c16-13(15-12-4-2-1-3-5-12)10-6-8-11(9-7-10)14(17)18/h6-9,12,17-18H,1-5H2,(H,15,16)
